C10H16FN3O2S — CID 115303754
4-[(2-amino-2-methylpropyl)amino]-3-fluorobenzenesulfonamide (PubChem CID 115303754) has the molecular formula C10H16FN3O2S and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-[(2-amino-2-methylpropyl)amino]-3-fluorobenzenesulfonamide.
| Compound Name | 4-[(2-amino-2-methylpropyl)amino]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 115303754 |
| Molecular Formula | C10H16FN3O2S |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4-[(2-amino-2-methylpropyl)amino]-3-fluorobenzenesulfonamide |
| SMILES | CC(C)(N)CNc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C10H16FN3O2S/c1-10(2,12)6-14-9-4-3-7(5-8(9)11)17(13,15)16/h3-5,14H,6,12H2,1-2H3,(H2,13,15,16) |
| InChIKey | JVIJVIFDXYXIJQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |