C13H19FN2O3S — CID 64911459
3-fluoro-4-[(2-hydroxycyclohexyl)methylamino]benzenesulfonamide (PubChem CID 64911459) has the molecular formula C13H19FN2O3S and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-fluoro-4-[(2-hydroxycyclohexyl)methylamino]benzenesulfonamide.
| Compound Name | 3-fluoro-4-[(2-hydroxycyclohexyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 64911459 |
| Molecular Formula | C13H19FN2O3S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 3-fluoro-4-[(2-hydroxycyclohexyl)methylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCC2CCCCC2O)c(F)c1 |
| InChI | InChI=1S/C13H19FN2O3S/c14-11-7-10(20(15,18)19)5-6-12(11)16-8-9-3-1-2-4-13(9)17/h5-7,9,13,16-17H,1-4,8H2,(H2,15,18,19) |
| InChIKey | IZDMBGGWMBQHST-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |