C13H19FN2O3S — CID 106000014
3-fluoro-4-[2-(oxan-2-yl)ethylamino]benzenesulfonamide (PubChem CID 106000014) has the molecular formula C13H19FN2O3S and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-fluoro-4-[2-(oxan-2-yl)ethylamino]benzenesulfonamide.
| Compound Name | 3-fluoro-4-[2-(oxan-2-yl)ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 106000014 |
| Molecular Formula | C13H19FN2O3S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 3-fluoro-4-[2-(oxan-2-yl)ethylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCCC2CCCCO2)c(F)c1 |
| InChI | InChI=1S/C13H19FN2O3S/c14-12-9-11(20(15,17)18)4-5-13(12)16-7-6-10-3-1-2-8-19-10/h4-5,9-10,16H,1-3,6-8H2,(H2,15,17,18) |
| InChIKey | VCISBYBNZVECQV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |