About 2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid
2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid (PubChem CID 64565907) has the molecular formula C10H8BrF3O4S
and a molecular weight of 361.14 g/mol. Its IUPAC name is 2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid.
Molecular Properties
| Compound Name | 2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid |
| PubChem CID | 64565907 |
| Molecular Formula | C10H8BrF3O4S |
| Molecular Weight | 361.14 g/mol |
| Exact Mass | 359.93 |
| IUPAC Name | 2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)CCC(F)(F)F)ccc1Br |
| InChI | InChI=1S/C10H8BrF3O4S/c11-8-2-1-6(5-7(8)9(15)16)19(17,18)4-3-10(12,13)14/h1-2,5H,3-4H2,(H,15,16) |
| InChIKey | GRPIKNBRMMALHZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.14 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid?
The IUPAC name of 2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid (CID 64565907) is 2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid.
What is the SMILES notation for 2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid?
The canonical SMILES for 2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid is O=C(O)c1cc(S(=O)(=O)CCC(F)(F)F)ccc1Br.
What is the InChIKey of 2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid?
The InChIKey is GRPIKNBRMMALHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrF3O4S/c11-8-2-1-6(5-7(8)9(15)16)19(17,18)4-3-10(12,13)14/h1-2,5H,3-4H2,(H,15,16).
What are the key properties of 2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid?
2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid has a molecular weight of 361.14 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid is sourced from PubChem (CID 64565907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).