C10H8BrF3O4S — CID 64565907
2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid (PubChem CID 64565907) has the molecular formula C10H8BrF3O4S and a molecular weight of 361.14 g/mol. Its IUPAC name is 2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid.
| Compound Name | 2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 64565907 |
| Molecular Formula | C10H8BrF3O4S |
| Molecular Weight | 361.14 g/mol |
| Exact Mass | 359.93 |
| IUPAC Name | 2-bromo-5-(3,3,3-trifluoropropylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)CCC(F)(F)F)ccc1Br |
| InChI | InChI=1S/C10H8BrF3O4S/c11-8-2-1-6(5-7(8)9(15)16)19(17,18)4-3-10(12,13)14/h1-2,5H,3-4H2,(H,15,16) |
| InChIKey | GRPIKNBRMMALHZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.14 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |