C13H18BrNO4S — CID 43140621
2-bromo-5-[2-(diethylamino)ethylsulfonyl]benzoic acid (PubChem CID 43140621) has the molecular formula C13H18BrNO4S and a molecular weight of 364.26 g/mol. Its IUPAC name is 2-bromo-5-[2-(diethylamino)ethylsulfonyl]benzoic acid.
| Compound Name | 2-bromo-5-[2-(diethylamino)ethylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 43140621 |
| Molecular Formula | C13H18BrNO4S |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 2-bromo-5-[2-(diethylamino)ethylsulfonyl]benzoic acid |
| SMILES | CCN(CC)CCS(=O)(=O)c1ccc(Br)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H18BrNO4S/c1-3-15(4-2)7-8-20(18,19)10-5-6-12(14)11(9-10)13(16)17/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,17) |
| InChIKey | VPMGQQYEDSKNMG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |