C15H22BrNO4S — CID 20505984
2-bromo-5-(dibutylsulfamoyl)benzoic acid (PubChem CID 20505984) has the molecular formula C15H22BrNO4S and a molecular weight of 392.32 g/mol. Its IUPAC name is 2-bromo-5-(dibutylsulfamoyl)benzoic acid.
| Compound Name | 2-bromo-5-(dibutylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 20505984 |
| Molecular Formula | C15H22BrNO4S |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 2-bromo-5-(dibutylsulfamoyl)benzoic acid |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(Br)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H22BrNO4S/c1-3-5-9-17(10-6-4-2)22(20,21)12-7-8-14(16)13(11-12)15(18)19/h7-8,11H,3-6,9-10H2,1-2H3,(H,18,19) |
| InChIKey | LGFQWCQZUMKUPO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |