C11H13BrNO4S- — CID 3668554
2-bromo-5-(diethylsulfamoyl)benzoate (PubChem CID 3668554) has the molecular formula C11H13BrNO4S- and a molecular weight of 335.20 g/mol. Its IUPAC name is 2-bromo-5-(diethylsulfamoyl)benzoate.
| Compound Name | 2-bromo-5-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 3668554 |
| Molecular Formula | C11H13BrNO4S- |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 2-bromo-5-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Br)c(C(=O)[O-])c1 |
| InChI | InChI=1S/C11H14BrNO4S/c1-3-13(4-2)18(16,17)8-5-6-10(12)9(7-8)11(14)15/h5-7H,3-4H2,1-2H3,(H,14,15)/p-1 |
| InChIKey | SUMISZHUFQXXJD-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |