C17H20BrN3O3S — CID 86932912
3-(anilinocarbamoyl)-4-bromo-N,N-diethylbenzenesulfonamide (PubChem CID 86932912) has the molecular formula C17H20BrN3O3S and a molecular weight of 426.34 g/mol. Its IUPAC name is 3-(anilinocarbamoyl)-4-bromo-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-(anilinocarbamoyl)-4-bromo-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 86932912 |
| Molecular Formula | C17H20BrN3O3S |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 3-(anilinocarbamoyl)-4-bromo-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Br)c(C(=O)NNc2ccccc2)c1 |
| InChI | InChI=1S/C17H20BrN3O3S/c1-3-21(4-2)25(23,24)14-10-11-16(18)15(12-14)17(22)20-19-13-8-6-5-7-9-13/h5-12,19H,3-4H2,1-2H3,(H,20,22) |
| InChIKey | LGSWCVWBLKCFDJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|