C17H17BrNO4S2- — CID 5252610
2-(4-bromophenyl)sulfanyl-5-(diethylsulfamoyl)benzoate (PubChem CID 5252610) has the molecular formula C17H17BrNO4S2- and a molecular weight of 443.36 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-5-(diethylsulfamoyl)benzoate.
| Compound Name | 2-(4-bromophenyl)sulfanyl-5-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 5252610 |
| Molecular Formula | C17H17BrNO4S2- |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-5-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Sc2ccc(Br)cc2)c(C(=O)[O-])c1 |
| InChI | InChI=1S/C17H18BrNO4S2/c1-3-19(4-2)25(22,23)14-9-10-16(15(11-14)17(20)21)24-13-7-5-12(18)6-8-13/h5-11H,3-4H2,1-2H3,(H,20,21)/p-1 |
| InChIKey | OMBKAJVJUZOTKL-UHFFFAOYSA-M |
| XLogP | 2.99 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |