C11H13BrO6S2 — CID 43807983
2-bromo-5-(2-ethylsulfonylethylsulfonyl)benzoic acid (PubChem CID 43807983) has the molecular formula C11H13BrO6S2 and a molecular weight of 385.26 g/mol. Its IUPAC name is 2-bromo-5-(2-ethylsulfonylethylsulfonyl)benzoic acid.
| Compound Name | 2-bromo-5-(2-ethylsulfonylethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 43807983 |
| Molecular Formula | C11H13BrO6S2 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | 2-bromo-5-(2-ethylsulfonylethylsulfonyl)benzoic acid |
| SMILES | CCS(=O)(=O)CCS(=O)(=O)c1ccc(Br)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H13BrO6S2/c1-2-19(15,16)5-6-20(17,18)8-3-4-10(12)9(7-8)11(13)14/h3-4,7H,2,5-6H2,1H3,(H,13,14) |
| InChIKey | MYHMKDBJUXMWKD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |