C12H10BrNO5S — CID 43140612
2-bromo-5-[2-oxo-2-(prop-2-ynylamino)ethyl]sulfonylbenzoic acid (PubChem CID 43140612) has the molecular formula C12H10BrNO5S and a molecular weight of 360.19 g/mol. Its IUPAC name is 2-bromo-5-[2-oxo-2-(prop-2-ynylamino)ethyl]sulfonylbenzoic acid.
| Compound Name | 2-bromo-5-[2-oxo-2-(prop-2-ynylamino)ethyl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 43140612 |
| Molecular Formula | C12H10BrNO5S |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 2-bromo-5-[2-oxo-2-(prop-2-ynylamino)ethyl]sulfonylbenzoic acid |
| SMILES | C#CCNC(=O)CS(=O)(=O)c1ccc(Br)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H10BrNO5S/c1-2-5-14-11(15)7-20(18,19)8-3-4-10(13)9(6-8)12(16)17/h1,3-4,6H,5,7H2,(H,14,15)(H,16,17) |
| InChIKey | LLIOJCJBYKQGMZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|