C11H9ClN2O5S — CID 43141007
2-chloro-5-[2-(cyanomethylamino)-2-oxoethyl]sulfonylbenzoic acid (PubChem CID 43141007) has the molecular formula C11H9ClN2O5S and a molecular weight of 316.72 g/mol. Its IUPAC name is 2-chloro-5-[2-(cyanomethylamino)-2-oxoethyl]sulfonylbenzoic acid.
| Compound Name | 2-chloro-5-[2-(cyanomethylamino)-2-oxoethyl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 43141007 |
| Molecular Formula | C11H9ClN2O5S |
| Molecular Weight | 316.72 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 2-chloro-5-[2-(cyanomethylamino)-2-oxoethyl]sulfonylbenzoic acid |
| SMILES | N#CCNC(=O)CS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H9ClN2O5S/c12-9-2-1-7(5-8(9)11(16)17)20(18,19)6-10(15)14-4-3-13/h1-2,5H,4,6H2,(H,14,15)(H,16,17) |
| InChIKey | QRJVGYFJYWVUIE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.72 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|