C11H8BrFN2O5S — CID 43323099
5-bromo-3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2-fluorobenzoic acid (PubChem CID 43323099) has the molecular formula C11H8BrFN2O5S and a molecular weight of 379.16 g/mol. Its IUPAC name is 5-bromo-3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2-fluorobenzoic acid.
| Compound Name | 5-bromo-3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 43323099 |
| Molecular Formula | C11H8BrFN2O5S |
| Molecular Weight | 379.16 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | 5-bromo-3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2-fluorobenzoic acid |
| SMILES | N#CCNC(=O)CS(=O)(=O)c1cc(Br)cc(C(=O)O)c1F |
| InChI | InChI=1S/C11H8BrFN2O5S/c12-6-3-7(11(17)18)10(13)8(4-6)21(19,20)5-9(16)15-2-1-14/h3-4H,2,5H2,(H,15,16)(H,17,18) |
| InChIKey | MVTNZNOOTAIJGK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|