C10H6BrCl2FO4S — CID 79173266
5-bromo-3-(2,3-dichloroprop-2-enylsulfonyl)-2-fluorobenzoic acid (PubChem CID 79173266) has the molecular formula C10H6BrCl2FO4S and a molecular weight of 392.03 g/mol. Its IUPAC name is 5-bromo-3-(2,3-dichloroprop-2-enylsulfonyl)-2-fluorobenzoic acid.
| Compound Name | 5-bromo-3-(2,3-dichloroprop-2-enylsulfonyl)-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 79173266 |
| Molecular Formula | C10H6BrCl2FO4S |
| Molecular Weight | 392.03 g/mol |
| Exact Mass | 389.85 |
| IUPAC Name | 5-bromo-3-(2,3-dichloroprop-2-enylsulfonyl)-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(Br)cc(S(=O)(=O)CC(Cl)=CCl)c1F |
| InChI | InChI=1S/C10H6BrCl2FO4S/c11-5-1-7(10(15)16)9(14)8(2-5)19(17,18)4-6(13)3-12/h1-3H,4H2,(H,15,16) |
| InChIKey | QJBNKXZVYYYKGW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.03 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |