C10H10BrFO6S2 — CID 60915571
5-bromo-2-fluoro-3-(2-methylsulfonylethylsulfonyl)benzoic acid (PubChem CID 60915571) has the molecular formula C10H10BrFO6S2 and a molecular weight of 389.22 g/mol. Its IUPAC name is 5-bromo-2-fluoro-3-(2-methylsulfonylethylsulfonyl)benzoic acid.
| Compound Name | 5-bromo-2-fluoro-3-(2-methylsulfonylethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 60915571 |
| Molecular Formula | C10H10BrFO6S2 |
| Molecular Weight | 389.22 g/mol |
| Exact Mass | 387.91 |
| IUPAC Name | 5-bromo-2-fluoro-3-(2-methylsulfonylethylsulfonyl)benzoic acid |
| SMILES | CS(=O)(=O)CCS(=O)(=O)c1cc(Br)cc(C(=O)O)c1F |
| InChI | InChI=1S/C10H10BrFO6S2/c1-19(15,16)2-3-20(17,18)8-5-6(11)4-7(9(8)12)10(13)14/h4-5H,2-3H2,1H3,(H,13,14) |
| InChIKey | VUISQOBDXJSQPW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |