C9H8ClFO4S — CID 43140650
5-chloro-3-ethylsulfonyl-2-fluorobenzoic acid (PubChem CID 43140650) has the molecular formula C9H8ClFO4S and a molecular weight of 266.68 g/mol. Its IUPAC name is 5-chloro-3-ethylsulfonyl-2-fluorobenzoic acid.
| Compound Name | 5-chloro-3-ethylsulfonyl-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 43140650 |
| Molecular Formula | C9H8ClFO4S |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 5-chloro-3-ethylsulfonyl-2-fluorobenzoic acid |
| SMILES | CCS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1F |
| InChI | InChI=1S/C9H8ClFO4S/c1-2-16(14,15)7-4-5(10)3-6(8(7)11)9(12)13/h3-4H,2H2,1H3,(H,12,13) |
| InChIKey | YRIYZNPLYZJUJZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |