C12H14ClFO5S — CID 104648173
5-chloro-2-fluoro-3-(4-methoxybutylsulfonyl)benzoic acid (PubChem CID 104648173) has the molecular formula C12H14ClFO5S and a molecular weight of 324.76 g/mol. Its IUPAC name is 5-chloro-2-fluoro-3-(4-methoxybutylsulfonyl)benzoic acid.
| Compound Name | 5-chloro-2-fluoro-3-(4-methoxybutylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 104648173 |
| Molecular Formula | C12H14ClFO5S |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 5-chloro-2-fluoro-3-(4-methoxybutylsulfonyl)benzoic acid |
| SMILES | COCCCCS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1F |
| InChI | InChI=1S/C12H14ClFO5S/c1-19-4-2-3-5-20(17,18)10-7-8(13)6-9(11(10)14)12(15)16/h6-7H,2-5H2,1H3,(H,15,16) |
| InChIKey | YJCPUNSWAROIPT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|