C9H8ClFN2O5S — CID 43141064
3-[(2-amino-2-oxoethyl)sulfamoyl]-5-chloro-2-fluorobenzoic acid (PubChem CID 43141064) has the molecular formula C9H8ClFN2O5S and a molecular weight of 310.69 g/mol. Its IUPAC name is 3-[(2-amino-2-oxoethyl)sulfamoyl]-5-chloro-2-fluorobenzoic acid.
| Compound Name | 3-[(2-amino-2-oxoethyl)sulfamoyl]-5-chloro-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 43141064 |
| Molecular Formula | C9H8ClFN2O5S |
| Molecular Weight | 310.69 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 3-[(2-amino-2-oxoethyl)sulfamoyl]-5-chloro-2-fluorobenzoic acid |
| SMILES | NC(=O)CNS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1F |
| InChI | InChI=1S/C9H8ClFN2O5S/c10-4-1-5(9(15)16)8(11)6(2-4)19(17,18)13-3-7(12)14/h1-2,13H,3H2,(H2,12,14)(H,15,16) |
| InChIKey | UZLWCYWFUDDAEQ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.69 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |