C9H8ClFN2O6S — CID 115992025
3-[(2-amino-2-oxoethoxy)sulfamoyl]-5-chloro-2-fluorobenzoic acid (PubChem CID 115992025) has the molecular formula C9H8ClFN2O6S and a molecular weight of 326.69 g/mol. Its IUPAC name is 3-[(2-amino-2-oxoethoxy)sulfamoyl]-5-chloro-2-fluorobenzoic acid.
| Compound Name | 3-[(2-amino-2-oxoethoxy)sulfamoyl]-5-chloro-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 115992025 |
| Molecular Formula | C9H8ClFN2O6S |
| Molecular Weight | 326.69 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 3-[(2-amino-2-oxoethoxy)sulfamoyl]-5-chloro-2-fluorobenzoic acid |
| SMILES | NC(=O)CONS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1F |
| InChI | InChI=1S/C9H8ClFN2O6S/c10-4-1-5(9(15)16)8(11)6(2-4)20(17,18)13-19-3-7(12)14/h1-2,13H,3H2,(H2,12,14)(H,15,16) |
| InChIKey | XNBUDKFFRLIPIJ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.69 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|