C11H12ClFO4S — CID 43140649
3-butylsulfonyl-5-chloro-2-fluorobenzoic acid (PubChem CID 43140649) has the molecular formula C11H12ClFO4S and a molecular weight of 294.73 g/mol. Its IUPAC name is 3-butylsulfonyl-5-chloro-2-fluorobenzoic acid.
| Compound Name | 3-butylsulfonyl-5-chloro-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 43140649 |
| Molecular Formula | C11H12ClFO4S |
| Molecular Weight | 294.73 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 3-butylsulfonyl-5-chloro-2-fluorobenzoic acid |
| SMILES | CCCCS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1F |
| InChI | InChI=1S/C11H12ClFO4S/c1-2-3-4-18(16,17)9-6-7(12)5-8(10(9)13)11(14)15/h5-6H,2-4H2,1H3,(H,14,15) |
| InChIKey | NUEFHJBXJZDBFW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.73 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |