C13H13ClFNO4S — CID 65252885
5-chloro-3-(3-cyano-3-methylbutyl)sulfonyl-2-fluorobenzoic acid (PubChem CID 65252885) has the molecular formula C13H13ClFNO4S and a molecular weight of 333.77 g/mol. Its IUPAC name is 5-chloro-3-(3-cyano-3-methylbutyl)sulfonyl-2-fluorobenzoic acid.
| Compound Name | 5-chloro-3-(3-cyano-3-methylbutyl)sulfonyl-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 65252885 |
| Molecular Formula | C13H13ClFNO4S |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 5-chloro-3-(3-cyano-3-methylbutyl)sulfonyl-2-fluorobenzoic acid |
| SMILES | CC(C)(C#N)CCS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1F |
| InChI | InChI=1S/C13H13ClFNO4S/c1-13(2,7-16)3-4-21(19,20)10-6-8(14)5-9(11(10)15)12(17)18/h5-6H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | ZHMHRUUJLITVIY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |