C13H14FNO4S — CID 65253042
5-(3-cyano-3-methylbutyl)sulfonyl-2-fluorobenzoic acid (PubChem CID 65253042) has the molecular formula C13H14FNO4S and a molecular weight of 299.32 g/mol. Its IUPAC name is 5-(3-cyano-3-methylbutyl)sulfonyl-2-fluorobenzoic acid.
| Compound Name | 5-(3-cyano-3-methylbutyl)sulfonyl-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 65253042 |
| Molecular Formula | C13H14FNO4S |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 5-(3-cyano-3-methylbutyl)sulfonyl-2-fluorobenzoic acid |
| SMILES | CC(C)(C#N)CCS(=O)(=O)c1ccc(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H14FNO4S/c1-13(2,8-15)5-6-20(18,19)9-3-4-11(14)10(7-9)12(16)17/h3-4,7H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | ZZGSLPSWFKNNNG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |