C12H13F2NO2S — CID 65262832
4-(2,4-difluorophenyl)sulfonyl-2,2-dimethylbutanenitrile (PubChem CID 65262832) has the molecular formula C12H13F2NO2S and a molecular weight of 273.30 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)sulfonyl-2,2-dimethylbutanenitrile.
| Compound Name | 4-(2,4-difluorophenyl)sulfonyl-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65262832 |
| Molecular Formula | C12H13F2NO2S |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 4-(2,4-difluorophenyl)sulfonyl-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H13F2NO2S/c1-12(2,8-15)5-6-18(16,17)11-4-3-9(13)7-10(11)14/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | LDVLUWTWLAPNMP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |