C14H21F2NO2S — CID 106714748
6-(2,4-difluorophenyl)sulfonyl-2,2-dimethylhexan-1-amine (PubChem CID 106714748) has the molecular formula C14H21F2NO2S and a molecular weight of 305.39 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)sulfonyl-2,2-dimethylhexan-1-amine.
| Compound Name | 6-(2,4-difluorophenyl)sulfonyl-2,2-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 106714748 |
| Molecular Formula | C14H21F2NO2S |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 6-(2,4-difluorophenyl)sulfonyl-2,2-dimethylhexan-1-amine |
| SMILES | CC(C)(CN)CCCCS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H21F2NO2S/c1-14(2,10-17)7-3-4-8-20(18,19)13-6-5-11(15)9-12(13)16/h5-6,9H,3-4,7-8,10,17H2,1-2H3 |
| InChIKey | HROGYQJJGFCNIN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|