C14H22ClNO2S — CID 106714731
6-(2-chlorophenyl)sulfonyl-2,2-dimethylhexan-1-amine (PubChem CID 106714731) has the molecular formula C14H22ClNO2S and a molecular weight of 303.85 g/mol. Its IUPAC name is 6-(2-chlorophenyl)sulfonyl-2,2-dimethylhexan-1-amine.
| Compound Name | 6-(2-chlorophenyl)sulfonyl-2,2-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 106714731 |
| Molecular Formula | C14H22ClNO2S |
| Molecular Weight | 303.85 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 6-(2-chlorophenyl)sulfonyl-2,2-dimethylhexan-1-amine |
| SMILES | CC(C)(CN)CCCCS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C14H22ClNO2S/c1-14(2,11-16)9-5-6-10-19(17,18)13-8-4-3-7-12(13)15/h3-4,7-8H,5-6,9-11,16H2,1-2H3 |
| InChIKey | VLSRNGXFNBYXAY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.85 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|