C13H19Cl2NO2S — CID 114149858
2-chloro-N-(5-chloro-2,2-dimethylpentyl)benzenesulfonamide (PubChem CID 114149858) has the molecular formula C13H19Cl2NO2S and a molecular weight of 324.27 g/mol. Its IUPAC name is 2-chloro-N-(5-chloro-2,2-dimethylpentyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-(5-chloro-2,2-dimethylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114149858 |
| Molecular Formula | C13H19Cl2NO2S |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2-chloro-N-(5-chloro-2,2-dimethylpentyl)benzenesulfonamide |
| SMILES | CC(C)(CCCCl)CNS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C13H19Cl2NO2S/c1-13(2,8-5-9-14)10-16-19(17,18)12-7-4-3-6-11(12)15/h3-4,6-7,16H,5,8-10H2,1-2H3 |
| InChIKey | DYENICGFHSMUCL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|