C11H19Cl2N3O2S — CID 114172640
4-chloro-N-(5-chloro-2,2-dimethylpentyl)-1-methylpyrazole-5-sulfonamide (PubChem CID 114172640) has the molecular formula C11H19Cl2N3O2S and a molecular weight of 328.27 g/mol. Its IUPAC name is 4-chloro-N-(5-chloro-2,2-dimethylpentyl)-1-methylpyrazole-5-sulfonamide.
| Compound Name | 4-chloro-N-(5-chloro-2,2-dimethylpentyl)-1-methylpyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 114172640 |
| Molecular Formula | C11H19Cl2N3O2S |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 4-chloro-N-(5-chloro-2,2-dimethylpentyl)-1-methylpyrazole-5-sulfonamide |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)NCC(C)(C)CCCCl |
| InChI | InChI=1S/C11H19Cl2N3O2S/c1-11(2,5-4-6-12)8-15-19(17,18)10-9(13)7-14-16(10)3/h7,15H,4-6,8H2,1-3H3 |
| InChIKey | LYRJXAKFJUCKGX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|