C7H9Cl2N3O2S — CID 106150652
4-chloro-N-(2-chloroprop-2-enyl)-1-methylpyrazole-5-sulfonamide (PubChem CID 106150652) has the molecular formula C7H9Cl2N3O2S and a molecular weight of 270.14 g/mol. Its IUPAC name is 4-chloro-N-(2-chloroprop-2-enyl)-1-methylpyrazole-5-sulfonamide.
| Compound Name | 4-chloro-N-(2-chloroprop-2-enyl)-1-methylpyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106150652 |
| Molecular Formula | C7H9Cl2N3O2S |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 268.98 |
| IUPAC Name | 4-chloro-N-(2-chloroprop-2-enyl)-1-methylpyrazole-5-sulfonamide |
| SMILES | C=C(Cl)CNS(=O)(=O)c1c(Cl)cnn1C |
| InChI | InChI=1S/C7H9Cl2N3O2S/c1-5(8)3-11-15(13,14)7-6(9)4-10-12(7)2/h4,11H,1,3H2,2H3 |
| InChIKey | FRARAIVLEDRIFX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |