C8H10BrClF3N3O2S — CID 114172631
N-(2-bromoethyl)-4-chloro-1-methyl-N-(2,2,2-trifluoroethyl)pyrazole-5-sulfonamide (PubChem CID 114172631) has the molecular formula C8H10BrClF3N3O2S and a molecular weight of 384.61 g/mol. Its IUPAC name is N-(2-bromoethyl)-4-chloro-1-methyl-N-(2,2,2-trifluoroethyl)pyrazole-5-sulfonamide.
| Compound Name | N-(2-bromoethyl)-4-chloro-1-methyl-N-(2,2,2-trifluoroethyl)pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 114172631 |
| Molecular Formula | C8H10BrClF3N3O2S |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 382.93 |
| IUPAC Name | N-(2-bromoethyl)-4-chloro-1-methyl-N-(2,2,2-trifluoroethyl)pyrazole-5-sulfonamide |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)N(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C8H10BrClF3N3O2S/c1-15-7(6(10)4-14-15)19(17,18)16(3-2-9)5-8(11,12)13/h4H,2-3,5H2,1H3 |
| InChIKey | XWISZAAODJPEEI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|