C9H14ClN3O4S — CID 106139180
3-[(4-chloro-1-methylpyrazol-5-yl)sulfonyl-methylamino]-2-methylpropanoic acid (PubChem CID 106139180) has the molecular formula C9H14ClN3O4S and a molecular weight of 295.75 g/mol. Its IUPAC name is 3-[(4-chloro-1-methylpyrazol-5-yl)sulfonyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(4-chloro-1-methylpyrazol-5-yl)sulfonyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 106139180 |
| Molecular Formula | C9H14ClN3O4S |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 3-[(4-chloro-1-methylpyrazol-5-yl)sulfonyl-methylamino]-2-methylpropanoic acid |
| SMILES | CC(CN(C)S(=O)(=O)c1c(Cl)cnn1C)C(=O)O |
| InChI | InChI=1S/C9H14ClN3O4S/c1-6(9(14)15)5-12(2)18(16,17)8-7(10)4-11-13(8)3/h4,6H,5H2,1-3H3,(H,14,15) |
| InChIKey | CEZPADQQQHQOFC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |