C8H11ClN2O2 — CID 83832130
3-(4-chloro-1-methylpyrazol-5-yl)-2-methylpropanoic acid (PubChem CID 83832130) has the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. Its IUPAC name is 3-(4-chloro-1-methylpyrazol-5-yl)-2-methylpropanoic acid.
| Compound Name | 3-(4-chloro-1-methylpyrazol-5-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 83832130 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 3-(4-chloro-1-methylpyrazol-5-yl)-2-methylpropanoic acid |
| SMILES | CC(Cc1c(Cl)cnn1C)C(=O)O |
| InChI | InChI=1S/C8H11ClN2O2/c1-5(8(12)13)3-7-6(9)4-10-11(7)2/h4-5H,3H2,1-2H3,(H,12,13) |
| InChIKey | DALYCVIGRWDVCZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |