C9H14ClN3O4S2 — CID 106139080
(2R)-2-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-4-methylsulfanylbutanoic acid (PubChem CID 106139080) has the molecular formula C9H14ClN3O4S2 and a molecular weight of 327.82 g/mol. Its IUPAC name is (2R)-2-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 106139080 |
| Molecular Formula | C9H14ClN3O4S2 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | (2R)-2-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NS(=O)(=O)c1c(Cl)cnn1C)C(=O)O |
| InChI | InChI=1S/C9H14ClN3O4S2/c1-13-8(6(10)5-11-13)19(16,17)12-7(9(14)15)3-4-18-2/h5,7,12H,3-4H2,1-2H3,(H,14,15)/t7-/m1/s1 |
| InChIKey | PTHCRXJYOHLMFJ-SSDOTTSWSA-N |
| XLogP | 0.56 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |