C10H13ClN2O4S — CID 55008419
3-[(2-chloro-3-pyridinyl)sulfonyl-methylamino]-2-methylpropanoic acid (PubChem CID 55008419) has the molecular formula C10H13ClN2O4S and a molecular weight of 292.74 g/mol. Its IUPAC name is 3-[(2-chloro-3-pyridinyl)sulfonyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(2-chloro-3-pyridinyl)sulfonyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 55008419 |
| Molecular Formula | C10H13ClN2O4S |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 3-[(2-chloro-3-pyridinyl)sulfonyl-methylamino]-2-methylpropanoic acid |
| SMILES | CC(CN(C)S(=O)(=O)c1cccnc1Cl)C(=O)O |
| InChI | InChI=1S/C10H13ClN2O4S/c1-7(10(14)15)6-13(2)18(16,17)8-4-3-5-12-9(8)11/h3-5,7H,6H2,1-2H3,(H,14,15) |
| InChIKey | CPRKYISSMKWIPH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|