C12H15N3O4S — CID 106545523
methyl 3-[(2-cyano-3-pyridinyl)sulfonyl-methylamino]-2-methylpropanoate (PubChem CID 106545523) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is methyl 3-[(2-cyano-3-pyridinyl)sulfonyl-methylamino]-2-methylpropanoate.
| Compound Name | methyl 3-[(2-cyano-3-pyridinyl)sulfonyl-methylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 106545523 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | methyl 3-[(2-cyano-3-pyridinyl)sulfonyl-methylamino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)CN(C)S(=O)(=O)c1cccnc1C#N |
| InChI | InChI=1S/C12H15N3O4S/c1-9(12(16)19-3)8-15(2)20(17,18)11-5-4-6-14-10(11)7-13/h4-6,9H,8H2,1-3H3 |
| InChIKey | SVMQWAFOZRAAHV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 100.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |