C13H11Cl3N2O2S — CID 61047622
2-chloro-N-[(3,5-dichlorophenyl)methyl]-N-methylpyridine-3-sulfonamide (PubChem CID 61047622) has the molecular formula C13H11Cl3N2O2S and a molecular weight of 365.67 g/mol. Its IUPAC name is 2-chloro-N-[(3,5-dichlorophenyl)methyl]-N-methylpyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-[(3,5-dichlorophenyl)methyl]-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61047622 |
| Molecular Formula | C13H11Cl3N2O2S |
| Molecular Weight | 365.67 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | 2-chloro-N-[(3,5-dichlorophenyl)methyl]-N-methylpyridine-3-sulfonamide |
| SMILES | CN(Cc1cc(Cl)cc(Cl)c1)S(=O)(=O)c1cccnc1Cl |
| InChI | InChI=1S/C13H11Cl3N2O2S/c1-18(8-9-5-10(14)7-11(15)6-9)21(19,20)12-3-2-4-17-13(12)16/h2-7H,8H2,1H3 |
| InChIKey | MTHAEUUIYFAKPQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.67 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|