C9H10ClN5O2S — CID 64517471
2-chloro-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-3-sulfonamide (PubChem CID 64517471) has the molecular formula C9H10ClN5O2S and a molecular weight of 287.73 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64517471 |
| Molecular Formula | C9H10ClN5O2S |
| Molecular Weight | 287.73 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2-chloro-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-3-sulfonamide |
| SMILES | CN(Cc1ncn[nH]1)S(=O)(=O)c1cccnc1Cl |
| InChI | InChI=1S/C9H10ClN5O2S/c1-15(5-8-12-6-13-14-8)18(16,17)7-3-2-4-11-9(7)10/h2-4,6H,5H2,1H3,(H,12,13,14) |
| InChIKey | PYCFDRIXWOHEJQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.73 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|