C10H17ClN4O2S2 — CID 106314518
3-[(4-chloro-1-methylpyrazol-5-yl)sulfonyl-ethylamino]-2-methylpropanethioamide (PubChem CID 106314518) has the molecular formula C10H17ClN4O2S2 and a molecular weight of 324.86 g/mol. Its IUPAC name is 3-[(4-chloro-1-methylpyrazol-5-yl)sulfonyl-ethylamino]-2-methylpropanethioamide.
| Compound Name | 3-[(4-chloro-1-methylpyrazol-5-yl)sulfonyl-ethylamino]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 106314518 |
| Molecular Formula | C10H17ClN4O2S2 |
| Molecular Weight | 324.86 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 3-[(4-chloro-1-methylpyrazol-5-yl)sulfonyl-ethylamino]-2-methylpropanethioamide |
| SMILES | CCN(CC(C)C(N)=S)S(=O)(=O)c1c(Cl)cnn1C |
| InChI | InChI=1S/C10H17ClN4O2S2/c1-4-15(6-7(2)9(12)18)19(16,17)10-8(11)5-13-14(10)3/h5,7H,4,6H2,1-3H3,(H2,12,18) |
| InChIKey | HYWYZAOYXNYSCZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.86 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|