C6H9ClIN3O2S — CID 106316125
4-chloro-N-(2-iodoethyl)-1-methylpyrazole-5-sulfonamide (PubChem CID 106316125) has the molecular formula C6H9ClIN3O2S and a molecular weight of 349.58 g/mol. Its IUPAC name is 4-chloro-N-(2-iodoethyl)-1-methylpyrazole-5-sulfonamide.
| Compound Name | 4-chloro-N-(2-iodoethyl)-1-methylpyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106316125 |
| Molecular Formula | C6H9ClIN3O2S |
| Molecular Weight | 349.58 g/mol |
| Exact Mass | 348.91 |
| IUPAC Name | 4-chloro-N-(2-iodoethyl)-1-methylpyrazole-5-sulfonamide |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)NCCI |
| InChI | InChI=1S/C6H9ClIN3O2S/c1-11-6(5(7)4-9-11)14(12,13)10-3-2-8/h4,10H,2-3H2,1H3 |
| InChIKey | BROIVPGZKLOSGC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.58 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|