C9H17ClN4O3S — CID 114172502
4-chloro-N-[2-(2-methoxyethylamino)ethyl]-1-methylpyrazole-5-sulfonamide (PubChem CID 114172502) has the molecular formula C9H17ClN4O3S and a molecular weight of 296.78 g/mol. Its IUPAC name is 4-chloro-N-[2-(2-methoxyethylamino)ethyl]-1-methylpyrazole-5-sulfonamide.
| Compound Name | 4-chloro-N-[2-(2-methoxyethylamino)ethyl]-1-methylpyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 114172502 |
| Molecular Formula | C9H17ClN4O3S |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-chloro-N-[2-(2-methoxyethylamino)ethyl]-1-methylpyrazole-5-sulfonamide |
| SMILES | COCCNCCNS(=O)(=O)c1c(Cl)cnn1C |
| InChI | InChI=1S/C9H17ClN4O3S/c1-14-9(8(10)7-12-14)18(15,16)13-4-3-11-5-6-17-2/h7,11,13H,3-6H2,1-2H3 |
| InChIKey | MFYJGJFLXFAMRS-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|