C8H15N3O3S — CID 19681770
N-(2-methoxyethyl)-1,5-dimethylpyrazole-4-sulfonamide (PubChem CID 19681770) has the molecular formula C8H15N3O3S and a molecular weight of 233.29 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1,5-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-(2-methoxyethyl)-1,5-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 19681770 |
| Molecular Formula | C8H15N3O3S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | N-(2-methoxyethyl)-1,5-dimethylpyrazole-4-sulfonamide |
| SMILES | COCCNS(=O)(=O)c1cnn(C)c1C |
| InChI | InChI=1S/C8H15N3O3S/c1-7-8(6-9-11(7)2)15(12,13)10-4-5-14-3/h6,10H,4-5H2,1-3H3 |
| InChIKey | IUHMALAMKCEMRB-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|