C11H15ClN6O4S — CID 19614564
N-[3-(4-chloro-3-nitropyrazol-1-yl)propyl]-1,5-dimethylpyrazole-4-sulfonamide (PubChem CID 19614564) has the molecular formula C11H15ClN6O4S and a molecular weight of 362.80 g/mol. Its IUPAC name is N-[3-(4-chloro-3-nitropyrazol-1-yl)propyl]-1,5-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-[3-(4-chloro-3-nitropyrazol-1-yl)propyl]-1,5-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 19614564 |
| Molecular Formula | C11H15ClN6O4S |
| Molecular Weight | 362.80 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | N-[3-(4-chloro-3-nitropyrazol-1-yl)propyl]-1,5-dimethylpyrazole-4-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)NCCCn2cc(Cl)c([N+](=O)[O-])n2)cnn1C |
| InChI | InChI=1S/C11H15ClN6O4S/c1-8-10(6-13-16(8)2)23(21,22)14-4-3-5-17-7-9(12)11(15-17)18(19)20/h6-7,14H,3-5H2,1-2H3 |
| InChIKey | ZTEHRVRYCOWTSH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.80 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|