C17H24ClN3O2S — CID 22207319
4-tert-butyl-N-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]benzenesulfonamide (PubChem CID 22207319) has the molecular formula C17H24ClN3O2S and a molecular weight of 369.92 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22207319 |
| Molecular Formula | C17H24ClN3O2S |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 4-tert-butyl-N-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]benzenesulfonamide |
| SMILES | Cc1nn(CCCNS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1Cl |
| InChI | InChI=1S/C17H24ClN3O2S/c1-13-16(18)12-21(20-13)11-5-10-19-24(22,23)15-8-6-14(7-9-15)17(2,3)4/h6-9,12,19H,5,10-11H2,1-4H3 |
| InChIKey | QOZCRMMXABTFCS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|