C16H24N4O2S — CID 127266249
4-tert-butyl-N-[3-(4-methyl-1,2,4-triazol-3-yl)propyl]benzenesulfonamide (PubChem CID 127266249) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-(4-methyl-1,2,4-triazol-3-yl)propyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[3-(4-methyl-1,2,4-triazol-3-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 127266249 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-tert-butyl-N-[3-(4-methyl-1,2,4-triazol-3-yl)propyl]benzenesulfonamide |
| SMILES | Cn1cnnc1CCCNS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H24N4O2S/c1-16(2,3)13-7-9-14(10-8-13)23(21,22)18-11-5-6-15-19-17-12-20(15)4/h7-10,12,18H,5-6,11H2,1-4H3 |
| InChIKey | OIDFSCLISNGSTC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|