C16H28N2O2S — CID 8716590
4-tert-butyl-N-[2-(diethylamino)ethyl]benzenesulfonamide (PubChem CID 8716590) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(diethylamino)ethyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[2-(diethylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8716590 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 4-tert-butyl-N-[2-(diethylamino)ethyl]benzenesulfonamide |
| SMILES | CCN(CC)CCNS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H28N2O2S/c1-6-18(7-2)13-12-17-21(19,20)15-10-8-14(9-11-15)16(3,4)5/h8-11,17H,6-7,12-13H2,1-5H3 |
| InChIKey | UYQUZIMKBWLXEY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |