C16H28N2O3S — CID 110425143
N-[2-[2-(diethylamino)ethoxy]ethyl]-4-ethylbenzenesulfonamide (PubChem CID 110425143) has the molecular formula C16H28N2O3S and a molecular weight of 328.48 g/mol. Its IUPAC name is N-[2-[2-(diethylamino)ethoxy]ethyl]-4-ethylbenzenesulfonamide.
| Compound Name | N-[2-[2-(diethylamino)ethoxy]ethyl]-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110425143 |
| Molecular Formula | C16H28N2O3S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[2-[2-(diethylamino)ethoxy]ethyl]-4-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCCOCCN(CC)CC)cc1 |
| InChI | InChI=1S/C16H28N2O3S/c1-4-15-7-9-16(10-8-15)22(19,20)17-11-13-21-14-12-18(5-2)6-3/h7-10,17H,4-6,11-14H2,1-3H3 |
| InChIKey | DXIGJJNVCFSGRJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|