C12H20Cl2N2O2S — CID 2998823
4-chloro-N-[2-(diethylamino)ethyl]benzenesulfonamide;hydron;chloride (PubChem CID 2998823) has the molecular formula C12H20Cl2N2O2S and a molecular weight of 327.28 g/mol. Its IUPAC name is 4-chloro-N-[2-(diethylamino)ethyl]benzenesulfonamide;hydron;chloride.
| Compound Name | 4-chloro-N-[2-(diethylamino)ethyl]benzenesulfonamide;hydron;chloride |
|---|---|
| PubChem CID | 2998823 |
| Molecular Formula | C12H20Cl2N2O2S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 4-chloro-N-[2-(diethylamino)ethyl]benzenesulfonamide;hydron;chloride |
| SMILES | CCN(CC)CCNS(=O)(=O)c1ccc(Cl)cc1.[Cl-].[H+] |
| InChI | InChI=1S/C12H19ClN2O2S.ClH/c1-3-15(4-2)10-9-14-18(16,17)12-7-5-11(13)6-8-12;/h5-8,14H,3-4,9-10H2,1-2H3;1H |
| InChIKey | UJCUNQVYPAUGQR-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |