C8H11ClIN3O4S — CID 114172625
methyl 3-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-2-iodopropanoate (PubChem CID 114172625) has the molecular formula C8H11ClIN3O4S and a molecular weight of 407.62 g/mol. Its IUPAC name is methyl 3-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-2-iodopropanoate.
| Compound Name | methyl 3-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-2-iodopropanoate |
|---|---|
| PubChem CID | 114172625 |
| Molecular Formula | C8H11ClIN3O4S |
| Molecular Weight | 407.62 g/mol |
| Exact Mass | 406.92 |
| IUPAC Name | methyl 3-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-2-iodopropanoate |
| SMILES | COC(=O)C(I)CNS(=O)(=O)c1c(Cl)cnn1C |
| InChI | InChI=1S/C8H11ClIN3O4S/c1-13-7(5(9)3-11-13)18(15,16)12-4-6(10)8(14)17-2/h3,6,12H,4H2,1-2H3 |
| InChIKey | BWSMXWWWEBDCMP-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.62 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|