C9H14ClN3O3S — CID 114150458
4-chloro-N-(2-cyclopropyl-2-hydroxyethyl)-1-methylpyrazole-5-sulfonamide (PubChem CID 114150458) has the molecular formula C9H14ClN3O3S and a molecular weight of 279.75 g/mol. Its IUPAC name is 4-chloro-N-(2-cyclopropyl-2-hydroxyethyl)-1-methylpyrazole-5-sulfonamide.
| Compound Name | 4-chloro-N-(2-cyclopropyl-2-hydroxyethyl)-1-methylpyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 114150458 |
| Molecular Formula | C9H14ClN3O3S |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 4-chloro-N-(2-cyclopropyl-2-hydroxyethyl)-1-methylpyrazole-5-sulfonamide |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)NCC(O)C1CC1 |
| InChI | InChI=1S/C9H14ClN3O3S/c1-13-9(7(10)4-11-13)17(15,16)12-5-8(14)6-2-3-6/h4,6,8,12,14H,2-3,5H2,1H3 |
| InChIKey | HBMIXLSWCIARET-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |