C10H16ClN3O3S — CID 106150733
4-chloro-N-[(2-hydroxycyclopentyl)methyl]-1-methylpyrazole-5-sulfonamide (PubChem CID 106150733) has the molecular formula C10H16ClN3O3S and a molecular weight of 293.78 g/mol. Its IUPAC name is 4-chloro-N-[(2-hydroxycyclopentyl)methyl]-1-methylpyrazole-5-sulfonamide.
| Compound Name | 4-chloro-N-[(2-hydroxycyclopentyl)methyl]-1-methylpyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106150733 |
| Molecular Formula | C10H16ClN3O3S |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 4-chloro-N-[(2-hydroxycyclopentyl)methyl]-1-methylpyrazole-5-sulfonamide |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)NCC1CCCC1O |
| InChI | InChI=1S/C10H16ClN3O3S/c1-14-10(8(11)6-12-14)18(16,17)13-5-7-3-2-4-9(7)15/h6-7,9,13,15H,2-5H2,1H3 |
| InChIKey | NUQIWVDCPBOVFI-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |