C9H13ClN4O2S — CID 106150633
4-chloro-N-(4-cyanobutyl)-1-methylpyrazole-5-sulfonamide (PubChem CID 106150633) has the molecular formula C9H13ClN4O2S and a molecular weight of 276.75 g/mol. Its IUPAC name is 4-chloro-N-(4-cyanobutyl)-1-methylpyrazole-5-sulfonamide.
| Compound Name | 4-chloro-N-(4-cyanobutyl)-1-methylpyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106150633 |
| Molecular Formula | C9H13ClN4O2S |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 4-chloro-N-(4-cyanobutyl)-1-methylpyrazole-5-sulfonamide |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)NCCCCC#N |
| InChI | InChI=1S/C9H13ClN4O2S/c1-14-9(8(10)7-12-14)17(15,16)13-6-4-2-3-5-11/h7,13H,2-4,6H2,1H3 |
| InChIKey | NDBDCNJFCCKZGZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|